C18H16N2O5S — CID 4895473
4-(4-methyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzenesulfonamide (PubChem CID 4895473) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-(4-methyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzenesulfonamide.
| Compound Name | 4-(4-methyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 4895473 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 4-(4-methyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzenesulfonamide |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)OCN(c1ccc(S(N)(=O)=O)cc1)C3 |
| InChI | InChI=1S/C18H16N2O5S/c1-11-8-17(21)25-18-14(11)6-7-16-15(18)9-20(10-24-16)12-2-4-13(5-3-12)26(19,22)23/h2-8H,9-10H2,1H3,(H2,19,22,23) |
| InChIKey | DZONKKHDFPITAQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|