C23H25N2O4+ — CID 7645092
4-methyl-9-[4-(morpholin-4-ium-4-ylmethyl)phenyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 7645092) has the molecular formula C23H25N2O4+ and a molecular weight of 393.46 g/mol. Its IUPAC name is 4-methyl-9-[4-(morpholin-4-ium-4-ylmethyl)phenyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 4-methyl-9-[4-(morpholin-4-ium-4-ylmethyl)phenyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 7645092 |
| Molecular Formula | C23H25N2O4+ |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 4-methyl-9-[4-(morpholin-4-ium-4-ylmethyl)phenyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)OCN(c1ccc(C[NH+]2CCOCC2)cc1)C3 |
| InChI | InChI=1S/C23H24N2O4/c1-16-12-22(26)29-23-19(16)6-7-21-20(23)14-25(15-28-21)18-4-2-17(3-5-18)13-24-8-10-27-11-9-24/h2-7,12H,8-11,13-15H2,1H3/p+1 |
| InChIKey | RJKJEGURLWQHPL-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|