C14H14N4O4S — CID 4982356
1-[(5-ethylthiophene-2-carbonyl)amino]-3-(4-nitrophenyl)urea (PubChem CID 4982356) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is 1-[(5-ethylthiophene-2-carbonyl)amino]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(5-ethylthiophene-2-carbonyl)amino]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 4982356 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-[(5-ethylthiophene-2-carbonyl)amino]-3-(4-nitrophenyl)urea |
| SMILES | CCc1ccc(C(=O)NNC(=O)Nc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C14H14N4O4S/c1-2-11-7-8-12(23-11)13(19)16-17-14(20)15-9-3-5-10(6-4-9)18(21)22/h3-8H,2H2,1H3,(H,16,19)(H2,15,17,20) |
| InChIKey | ZAIVOUKFPSNGED-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|