C24H26N4O2S — CID 4984328
3-[(2-pentylsulfanylpyridine-3-carbonyl)amino]-1,1-diphenylurea (PubChem CID 4984328) has the molecular formula C24H26N4O2S and a molecular weight of 434.56 g/mol. Its IUPAC name is 3-[(2-pentylsulfanylpyridine-3-carbonyl)amino]-1,1-diphenylurea.
| Compound Name | 3-[(2-pentylsulfanylpyridine-3-carbonyl)amino]-1,1-diphenylurea |
|---|---|
| PubChem CID | 4984328 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 3-[(2-pentylsulfanylpyridine-3-carbonyl)amino]-1,1-diphenylurea |
| SMILES | CCCCCSc1ncccc1C(=O)NNC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O2S/c1-2-3-10-18-31-23-21(16-11-17-25-23)22(29)26-27-24(30)28(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,11-17H,2-3,10,18H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | MOMLLKKADFGHKW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|