C16H15N7O2S — CID 4984386
[2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]-(thiadiazol-4-yl)methanone (PubChem CID 4984386) has the molecular formula C16H15N7O2S and a molecular weight of 369.41 g/mol. Its IUPAC name is [2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 4984386 |
| Molecular Formula | C16H15N7O2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]-(thiadiazol-4-yl)methanone |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)N1CCCN1C(=O)c1csnn1 |
| InChI | InChI=1S/C16H15N7O2S/c1-11-14(19-23(18-11)12-6-3-2-4-7-12)16(25)22-9-5-8-21(22)15(24)13-10-26-20-17-13/h2-4,6-7,10H,5,8-9H2,1H3 |
| InChIKey | PCJWWBAXVTWBHX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |