C20H20N6O2 — CID 3698286
[2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]-(6-methyl-3-pyridinyl)methanone (PubChem CID 3698286) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is [2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]-(6-methyl-3-pyridinyl)methanone.
| Compound Name | [2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]-(6-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 3698286 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]-(6-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCCN2C(=O)c2nn(-c3ccccc3)nc2C)cn1 |
| InChI | InChI=1S/C20H20N6O2/c1-14-9-10-16(13-21-14)19(27)24-11-6-12-25(24)20(28)18-15(2)22-26(23-18)17-7-4-3-5-8-17/h3-5,7-10,13H,6,11-12H2,1-2H3 |
| InChIKey | UIZPGZNOIUDOQC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |