C18H23N5O3 — CID 3856805
3-ethoxy-1-[2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]propan-1-one (PubChem CID 3856805) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-ethoxy-1-[2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]propan-1-one.
| Compound Name | 3-ethoxy-1-[2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 3856805 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-ethoxy-1-[2-(5-methyl-2-phenyltriazole-4-carbonyl)pyrazolidin-1-yl]propan-1-one |
| SMILES | CCOCCC(=O)N1CCCN1C(=O)c1nn(-c2ccccc2)nc1C |
| InChI | InChI=1S/C18H23N5O3/c1-3-26-13-10-16(24)21-11-7-12-22(21)18(25)17-14(2)19-23(20-17)15-8-5-4-6-9-15/h4-6,8-9H,3,7,10-13H2,1-2H3 |
| InChIKey | TXHZVHROOHLNFO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|