C16H22N2O5S — CID 3436543
3-ethoxy-1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]propan-1-one (PubChem CID 3436543) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 3-ethoxy-1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]propan-1-one.
| Compound Name | 3-ethoxy-1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 3436543 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-ethoxy-1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]propan-1-one |
| SMILES | CCOCCC(=O)N1CCCN1C(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C16H22N2O5S/c1-3-23-12-9-15(19)17-10-6-11-18(17)16(20)13-7-4-5-8-14(13)24(2,21)22/h4-5,7-8H,3,6,9-12H2,1-2H3 |
| InChIKey | RRNIZFAMDYNMDN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|