C17H16FN3O4S — CID 3769600
(2-fluoro-3-pyridinyl)-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]methanone (PubChem CID 3769600) has the molecular formula C17H16FN3O4S and a molecular weight of 377.40 g/mol. Its IUPAC name is (2-fluoro-3-pyridinyl)-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]methanone.
| Compound Name | (2-fluoro-3-pyridinyl)-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]methanone |
|---|---|
| PubChem CID | 3769600 |
| Molecular Formula | C17H16FN3O4S |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (2-fluoro-3-pyridinyl)-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)N1CCCN1C(=O)c1cccnc1F |
| InChI | InChI=1S/C17H16FN3O4S/c1-26(24,25)14-8-3-2-6-12(14)16(22)20-10-5-11-21(20)17(23)13-7-4-9-19-15(13)18/h2-4,6-9H,5,10-11H2,1H3 |
| InChIKey | OTHQXSTVMUPADM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|