C15H18N2O4S — CID 3561600
1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]but-2-en-1-one (PubChem CID 3561600) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]but-2-en-1-one.
| Compound Name | 1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 3561600 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]but-2-en-1-one |
| SMILES | CC=CC(=O)N1CCCN1C(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C15H18N2O4S/c1-3-7-14(18)16-10-6-11-17(16)15(19)12-8-4-5-9-13(12)22(2,20)21/h3-5,7-9H,6,10-11H2,1-2H3 |
| InChIKey | QGIWLPAWHLCLPZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|