C14H18N2O5S — CID 3561599
2-methoxy-1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]ethanone (PubChem CID 3561599) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-methoxy-1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 3561599 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-methoxy-1-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCCN1C(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H18N2O5S/c1-21-10-13(17)15-8-5-9-16(15)14(18)11-6-3-4-7-12(11)22(2,19)20/h3-4,6-7H,5,8-10H2,1-2H3 |
| InChIKey | UBUDJVIQFOWGKF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |