C24H23F4N5O4 — CID 4987892
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]piperidine-4-carboxamide (PubChem CID 4987892) has the molecular formula C24H23F4N5O4 and a molecular weight of 521.47 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]piperidine-4-carboxamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 4987892 |
| Molecular Formula | C24H23F4N5O4 |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]piperidine-4-carboxamide |
| SMILES | O=C(NC1(C(=O)NCCc2c[nH]c3ccc(F)cc23)CCNCC1)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H23F4N5O4/c25-17-1-2-20-19(12-17)14(13-31-20)3-6-30-22(35)23(4-7-29-8-5-23)32-21(34)15-9-16(24(26,27)28)11-18(10-15)33(36)37/h1-2,9-13,29,31H,3-8H2,(H,30,35)(H,32,34) |
| InChIKey | ZIMWHDSSRIZSFA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|