C13H16N2O3 — CID 4994104
N-(3,5-dimethoxyphenyl)-2,5-dihydropyrrole-1-carboxamide (PubChem CID 4994104) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 4994104 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2,5-dihydropyrrole-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CC=CC2)cc(OC)c1 |
| InChI | InChI=1S/C13H16N2O3/c1-17-11-7-10(8-12(9-11)18-2)14-13(16)15-5-3-4-6-15/h3-4,7-9H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | UOYXJADMDNYXEJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|