C11H12N4O3 — CID 53297658
N-(3,5-dimethoxyphenyl)-1,2,4-triazole-4-carboxamide (PubChem CID 53297658) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1,2,4-triazole-4-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-1,2,4-triazole-4-carboxamide |
|---|---|
| PubChem CID | 53297658 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1,2,4-triazole-4-carboxamide |
| SMILES | COc1cc(NC(=O)n2cnnc2)cc(OC)c1 |
| InChI | InChI=1S/C11H12N4O3/c1-17-9-3-8(4-10(5-9)18-2)14-11(16)15-6-12-13-7-15/h3-7H,1-2H3,(H,14,16) |
| InChIKey | HVGNSUOZHAWVFX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |