C27H43NO3 — CID 4995711
3-(2,6-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate (PubChem CID 4995711) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is 3-(2,6-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate.
| Compound Name | 3-(2,6-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate |
|---|---|
| PubChem CID | 4995711 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | 3-(2,6-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate |
| SMILES | CC(=CC(=O)OCCCc1c(C(C)(C)C)cc(O)cc1C(C)(C)C)NC1CCCCC1 |
| InChI | InChI=1S/C27H43NO3/c1-19(28-20-12-9-8-10-13-20)16-25(30)31-15-11-14-22-23(26(2,3)4)17-21(29)18-24(22)27(5,6)7/h16-18,20,28-29H,8-15H2,1-7H3 |
| InChIKey | ILZAKBZNOVDNEZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|