C14H12Br2N2O — CID 5001821
N'-(2,4-dibromophenyl)-2-phenylacetohydrazide (PubChem CID 5001821) has the molecular formula C14H12Br2N2O and a molecular weight of 384.07 g/mol. Its IUPAC name is N'-(2,4-dibromophenyl)-2-phenylacetohydrazide.
| Compound Name | N'-(2,4-dibromophenyl)-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 5001821 |
| Molecular Formula | C14H12Br2N2O |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | N'-(2,4-dibromophenyl)-2-phenylacetohydrazide |
| SMILES | O=C(Cc1ccccc1)NNc1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H12Br2N2O/c15-11-6-7-13(12(16)9-11)17-18-14(19)8-10-4-2-1-3-5-10/h1-7,9,17H,8H2,(H,18,19) |
| InChIKey | IPTGWZMPVGVHMZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|