C12H14BrN3OS — CID 21205686
N'-[5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-2-phenylacetohydrazide (PubChem CID 21205686) has the molecular formula C12H14BrN3OS and a molecular weight of 328.24 g/mol. Its IUPAC name is N'-[5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 21205686 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | N'-[5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]-2-phenylacetohydrazide |
| SMILES | O=C(Cc1ccccc1)NNC1=NCC(CBr)S1 |
| InChI | InChI=1S/C12H14BrN3OS/c13-7-10-8-14-12(18-10)16-15-11(17)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,16)(H,15,17) |
| InChIKey | ZNOWCASEVSZICP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|