C14H13BrN2OS — CID 2207905
N'-[1-(5-bromothiophen-2-yl)ethenyl]-2-phenylacetohydrazide (PubChem CID 2207905) has the molecular formula C14H13BrN2OS and a molecular weight of 337.24 g/mol. Its IUPAC name is N'-[1-(5-bromothiophen-2-yl)ethenyl]-2-phenylacetohydrazide.
| Compound Name | N'-[1-(5-bromothiophen-2-yl)ethenyl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 2207905 |
| Molecular Formula | C14H13BrN2OS |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N'-[1-(5-bromothiophen-2-yl)ethenyl]-2-phenylacetohydrazide |
| SMILES | C=C(NNC(=O)Cc1ccccc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H13BrN2OS/c1-10(12-7-8-13(15)19-12)16-17-14(18)9-11-5-3-2-4-6-11/h2-8,16H,1,9H2,(H,17,18) |
| InChIKey | COPWWCHNPLCRDN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|