C24H17Cl3N4OS — CID 5005059
4,6,7-tris(4-chlorophenyl)-2-sulfanylidene-3,4,7,8-tetrahydro-1H-pyrimido[4,5-d]pyrimidin-5-one (PubChem CID 5005059) has the molecular formula C24H17Cl3N4OS and a molecular weight of 515.85 g/mol. Its IUPAC name is 4,6,7-tris(4-chlorophenyl)-2-sulfanylidene-3,4,7,8-tetrahydro-1H-pyrimido[4,5-d]pyrimidin-5-one.
| Compound Name | 4,6,7-tris(4-chlorophenyl)-2-sulfanylidene-3,4,7,8-tetrahydro-1H-pyrimido[4,5-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 5005059 |
| Molecular Formula | C24H17Cl3N4OS |
| Molecular Weight | 515.85 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 4,6,7-tris(4-chlorophenyl)-2-sulfanylidene-3,4,7,8-tetrahydro-1H-pyrimido[4,5-d]pyrimidin-5-one |
| SMILES | O=C1C2=C(NC(=S)NC2c2ccc(Cl)cc2)NC(c2ccc(Cl)cc2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17Cl3N4OS/c25-15-5-1-13(2-6-15)20-19-21(30-24(33)28-20)29-22(14-3-7-16(26)8-4-14)31(23(19)32)18-11-9-17(27)10-12-18/h1-12,20,22,29H,(H2,28,30,33) |
| InChIKey | DDYQKZUSGWNVSC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.85 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|