C19H23NO4S — CID 5016545
4-(4-butoxyphenyl)sulfonyl-3-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 5016545) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)sulfonyl-3-methyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(4-butoxyphenyl)sulfonyl-3-methyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 5016545 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-(4-butoxyphenyl)sulfonyl-3-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2c3ccccc3OCC2C)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-3-4-13-23-16-9-11-17(12-10-16)25(21,22)20-15(2)14-24-19-8-6-5-7-18(19)20/h5-12,15H,3-4,13-14H2,1-2H3 |
| InChIKey | NQRRMAICFMIOAJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|