C11H9Cl3N2S — CID 5020525
1-[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 5020525) has the molecular formula C11H9Cl3N2S and a molecular weight of 307.63 g/mol. Its IUPAC name is 1-[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 1-[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 5020525 |
| Molecular Formula | C11H9Cl3N2S |
| Molecular Weight | 307.63 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 1-[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | CC(N)c1nc(-c2ccc(Cl)c(Cl)c2Cl)cs1 |
| InChI | InChI=1S/C11H9Cl3N2S/c1-5(15)11-16-8(4-17-11)6-2-3-7(12)10(14)9(6)13/h2-5H,15H2,1H3 |
| InChIKey | IHDQXWAXVQCICE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|