C9H6Cl3N3S — CID 7174069
[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 7174069) has the molecular formula C9H6Cl3N3S and a molecular weight of 294.59 g/mol. Its IUPAC name is [4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 7174069 |
| Molecular Formula | C9H6Cl3N3S |
| Molecular Weight | 294.59 g/mol |
| Exact Mass | 292.93 |
| IUPAC Name | [4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc(Cl)c(Cl)c2Cl)cs1 |
| InChI | InChI=1S/C9H6Cl3N3S/c10-5-2-1-4(7(11)8(5)12)6-3-16-9(14-6)15-13/h1-3H,13H2,(H,14,15) |
| InChIKey | JSXOZDXCLPICNB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|