C18H17BrN2OS — CID 5020732
(2-benzylimino-1,3-thiazinan-3-yl)-(3-bromophenyl)methanone (PubChem CID 5020732) has the molecular formula C18H17BrN2OS and a molecular weight of 389.32 g/mol. Its IUPAC name is (2-benzylimino-1,3-thiazinan-3-yl)-(3-bromophenyl)methanone.
| Compound Name | (2-benzylimino-1,3-thiazinan-3-yl)-(3-bromophenyl)methanone |
|---|---|
| PubChem CID | 5020732 |
| Molecular Formula | C18H17BrN2OS |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | (2-benzylimino-1,3-thiazinan-3-yl)-(3-bromophenyl)methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCCS/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C18H17BrN2OS/c19-16-9-4-8-15(12-16)17(22)21-10-5-11-23-18(21)20-13-14-6-2-1-3-7-14/h1-4,6-9,12H,5,10-11,13H2/b20-18- |
| InChIKey | JWRYQXWAYYVPNA-ZZEZOPTASA-N |
| XLogP | 4.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|