C25H27Cl2NO8 — CID 503144
methyl 3-chloro-5-[1-(3-chloro-4-methoxy-5-methoxycarbonylphenyl)-4-(ethoxycarbonylamino)but-1-enyl]-2-methoxybenzoate (PubChem CID 503144) has the molecular formula C25H27Cl2NO8 and a molecular weight of 540.40 g/mol. Its IUPAC name is methyl 3-chloro-5-[1-(3-chloro-4-methoxy-5-methoxycarbonylphenyl)-4-(ethoxycarbonylamino)but-1-enyl]-2-methoxybenzoate.
| Compound Name | methyl 3-chloro-5-[1-(3-chloro-4-methoxy-5-methoxycarbonylphenyl)-4-(ethoxycarbonylamino)but-1-enyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 503144 |
| Molecular Formula | C25H27Cl2NO8 |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | methyl 3-chloro-5-[1-(3-chloro-4-methoxy-5-methoxycarbonylphenyl)-4-(ethoxycarbonylamino)but-1-enyl]-2-methoxybenzoate |
| SMILES | CCOC(=O)NCCC=C(c1cc(Cl)c(OC)c(C(=O)OC)c1)c1cc(Cl)c(OC)c(C(=O)OC)c1 |
| InChI | InChI=1S/C25H27Cl2NO8/c1-6-36-25(31)28-9-7-8-16(14-10-17(23(29)34-4)21(32-2)19(26)12-14)15-11-18(24(30)35-5)22(33-3)20(27)13-15/h8,10-13H,6-7,9H2,1-5H3,(H,28,31) |
| InChIKey | LLPDAJIILPDBOG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|