C25H26Cl2O6 — CID 20590802
methyl 3-chloro-5-[1-(3-chloro-5-methoxycarbonyl-4-methylphenyl)-6-methoxy-6-oxohex-1-enyl]-2-methylbenzoate (PubChem CID 20590802) has the molecular formula C25H26Cl2O6 and a molecular weight of 493.38 g/mol. Its IUPAC name is methyl 3-chloro-5-[1-(3-chloro-5-methoxycarbonyl-4-methylphenyl)-6-methoxy-6-oxohex-1-enyl]-2-methylbenzoate.
| Compound Name | methyl 3-chloro-5-[1-(3-chloro-5-methoxycarbonyl-4-methylphenyl)-6-methoxy-6-oxohex-1-enyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 20590802 |
| Molecular Formula | C25H26Cl2O6 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | methyl 3-chloro-5-[1-(3-chloro-5-methoxycarbonyl-4-methylphenyl)-6-methoxy-6-oxohex-1-enyl]-2-methylbenzoate |
| SMILES | COC(=O)CCCC=C(c1cc(Cl)c(C)c(C(=O)OC)c1)c1cc(Cl)c(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C25H26Cl2O6/c1-14-19(24(29)32-4)10-16(12-21(14)26)18(8-6-7-9-23(28)31-3)17-11-20(25(30)33-5)15(2)22(27)13-17/h8,10-13H,6-7,9H2,1-5H3 |
| InChIKey | GLDWZKZCSOOZJQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|