C29H36O8 — CID 71045943
methyl 6,6-bis[4-methoxy-3-(2-methoxy-2-oxoethyl)-5-methylphenyl]hex-5-enoate (PubChem CID 71045943) has the molecular formula C29H36O8 and a molecular weight of 512.60 g/mol. Its IUPAC name is methyl 6,6-bis[4-methoxy-3-(2-methoxy-2-oxoethyl)-5-methylphenyl]hex-5-enoate.
| Compound Name | methyl 6,6-bis[4-methoxy-3-(2-methoxy-2-oxoethyl)-5-methylphenyl]hex-5-enoate |
|---|---|
| PubChem CID | 71045943 |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | methyl 6,6-bis[4-methoxy-3-(2-methoxy-2-oxoethyl)-5-methylphenyl]hex-5-enoate |
| SMILES | COC(=O)CCCC=C(c1cc(C)c(OC)c(CC(=O)OC)c1)c1cc(C)c(OC)c(CC(=O)OC)c1 |
| InChI | InChI=1S/C29H36O8/c1-18-12-20(14-22(28(18)36-6)16-26(31)34-4)24(10-8-9-11-25(30)33-3)21-13-19(2)29(37-7)23(15-21)17-27(32)35-5/h10,12-15H,8-9,11,16-17H2,1-7H3 |
| InChIKey | UFRSCXJLJKKUSK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|