C26H29ClO8 — CID 5327756
methyl 5-[(Z)-1-(3-chloro-4-methoxy-5-methoxycarbonylphenyl)-6-methoxy-6-oxohex-1-enyl]-2-methoxy-3-methylbenzoate (PubChem CID 5327756) has the molecular formula C26H29ClO8 and a molecular weight of 504.96 g/mol. Its IUPAC name is methyl 5-[(Z)-1-(3-chloro-4-methoxy-5-methoxycarbonylphenyl)-6-methoxy-6-oxohex-1-enyl]-2-methoxy-3-methylbenzoate.
| Compound Name | methyl 5-[(Z)-1-(3-chloro-4-methoxy-5-methoxycarbonylphenyl)-6-methoxy-6-oxohex-1-enyl]-2-methoxy-3-methylbenzoate |
|---|---|
| PubChem CID | 5327756 |
| Molecular Formula | C26H29ClO8 |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | methyl 5-[(Z)-1-(3-chloro-4-methoxy-5-methoxycarbonylphenyl)-6-methoxy-6-oxohex-1-enyl]-2-methoxy-3-methylbenzoate |
| SMILES | COC(=O)CCC/C=C(/c1cc(C)c(OC)c(C(=O)OC)c1)c1cc(Cl)c(OC)c(C(=O)OC)c1 |
| InChI | InChI=1S/C26H29ClO8/c1-15-11-16(12-19(23(15)32-3)25(29)34-5)18(9-7-8-10-22(28)31-2)17-13-20(26(30)35-6)24(33-4)21(27)14-17/h9,11-14H,7-8,10H2,1-6H3/b18-9- |
| InChIKey | TXICVCCWQNDLLY-NVMNQCDNSA-N |
| XLogP | 5.01 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|