C25H29Cl2N3O6 — CID 20590757
3-chloro-5-[1-[3-chloro-5-(methoxycarbamoyl)-4-methylphenyl]-6-(methoxyamino)-6-oxohex-1-enyl]-N-methoxy-2-methylbenzamide (PubChem CID 20590757) has the molecular formula C25H29Cl2N3O6 and a molecular weight of 538.43 g/mol. Its IUPAC name is 3-chloro-5-[1-[3-chloro-5-(methoxycarbamoyl)-4-methylphenyl]-6-(methoxyamino)-6-oxohex-1-enyl]-N-methoxy-2-methylbenzamide.
| Compound Name | 3-chloro-5-[1-[3-chloro-5-(methoxycarbamoyl)-4-methylphenyl]-6-(methoxyamino)-6-oxohex-1-enyl]-N-methoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 20590757 |
| Molecular Formula | C25H29Cl2N3O6 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 3-chloro-5-[1-[3-chloro-5-(methoxycarbamoyl)-4-methylphenyl]-6-(methoxyamino)-6-oxohex-1-enyl]-N-methoxy-2-methylbenzamide |
| SMILES | CONC(=O)CCCC=C(c1cc(Cl)c(C)c(C(=O)NOC)c1)c1cc(Cl)c(C)c(C(=O)NOC)c1 |
| InChI | InChI=1S/C25H29Cl2N3O6/c1-14-19(24(32)29-35-4)10-16(12-21(14)26)18(8-6-7-9-23(31)28-34-3)17-11-20(25(33)30-36-5)15(2)22(27)13-17/h8,10-13H,6-7,9H2,1-5H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | FMCGQUIKBBERHM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|