C25H25N3OS — CID 5034122
4-(4-methoxyphenyl)-2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-1,3-thiazole (PubChem CID 5034122) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-1,3-thiazole.
| Compound Name | 4-(4-methoxyphenyl)-2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 5034122 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(N3CCn4c5c(c6cc(C)ccc64)CCCC53)n2)cc1 |
| InChI | InChI=1S/C25H25N3OS/c1-16-6-11-22-20(14-16)19-4-3-5-23-24(19)27(22)12-13-28(23)25-26-21(15-30-25)17-7-9-18(29-2)10-8-17/h6-11,14-15,23H,3-5,12-13H2,1-2H3 |
| InChIKey | VHOCQZAAVRYCQG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|