C27H32N2O3S — CID 3260496
12-cyclohexyl-4-(4-methoxyphenyl)sulfonyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene (PubChem CID 3260496) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 12-cyclohexyl-4-(4-methoxyphenyl)sulfonyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene.
| Compound Name | 12-cyclohexyl-4-(4-methoxyphenyl)sulfonyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
|---|---|
| PubChem CID | 3260496 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 12-cyclohexyl-4-(4-methoxyphenyl)sulfonyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
| SMILES | COc1ccc(S(=O)(=O)N2CCn3c4c(c5cc(C6CCCCC6)ccc53)CCCC42)cc1 |
| InChI | InChI=1S/C27H32N2O3S/c1-32-21-11-13-22(14-12-21)33(30,31)29-17-16-28-25-15-10-20(19-6-3-2-4-7-19)18-24(25)23-8-5-9-26(29)27(23)28/h10-15,18-19,26H,2-9,16-17H2,1H3 |
| InChIKey | AIMHTSNVEVBQDO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|