C21H26N2O — CID 2246137
(5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbaldehyde (PubChem CID 2246137) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbaldehyde.
| Compound Name | (5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbaldehyde |
|---|---|
| PubChem CID | 2246137 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbaldehyde |
| SMILES | O=CN1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCC[C@@H]31 |
| InChI | InChI=1S/C21H26N2O/c24-14-22-11-12-23-19-10-9-16(15-5-2-1-3-6-15)13-18(19)17-7-4-8-20(22)21(17)23/h9-10,13-15,20H,1-8,11-12H2/t20-/m0/s1 |
| InChIKey | UOJLQHNMRPTANJ-FQEVSTJZSA-N |
| XLogP | 4.54 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|