C27H31N3S — CID 1112376
(5S)-12-cyclohexyl-N-phenyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbothioamide (PubChem CID 1112376) has the molecular formula C27H31N3S and a molecular weight of 429.63 g/mol. Its IUPAC name is (5S)-12-cyclohexyl-N-phenyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbothioamide.
| Compound Name | (5S)-12-cyclohexyl-N-phenyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbothioamide |
|---|---|
| PubChem CID | 1112376 |
| Molecular Formula | C27H31N3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (5S)-12-cyclohexyl-N-phenyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene-4-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCC[C@@H]31 |
| InChI | InChI=1S/C27H31N3S/c31-27(28-21-10-5-2-6-11-21)30-17-16-29-24-15-14-20(19-8-3-1-4-9-19)18-23(24)22-12-7-13-25(30)26(22)29/h2,5-6,10-11,14-15,18-19,25H,1,3-4,7-9,12-13,16-17H2,(H,28,31)/t25-/m0/s1 |
| InChIKey | BOPWUPRJDPCGLA-VWLOTQADSA-N |
| XLogP | 6.78 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|