C24H29N5OS2 — CID 92698973
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethanone (PubChem CID 92698973) has the molecular formula C24H29N5OS2 and a molecular weight of 467.66 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethanone.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethanone |
|---|---|
| PubChem CID | 92698973 |
| Molecular Formula | C24H29N5OS2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethanone |
| SMILES | Nc1nnc(SCC(=O)N2CCn3c4c(c5cc(C6CCCCC6)ccc53)CCC[C@H]42)s1 |
| InChI | InChI=1S/C24H29N5OS2/c25-23-26-27-24(32-23)31-14-21(30)28-11-12-29-19-10-9-16(15-5-2-1-3-6-15)13-18(19)17-7-4-8-20(28)22(17)29/h9-10,13,15,20H,1-8,11-12,14H2,(H2,25,26)/t20-/m1/s1 |
| InChIKey | JRFCPGAYMVEZSE-HXUWFJFHSA-N |
| XLogP | 5.13 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|