C27H29ClN2O — CID 6567138
(2-chlorophenyl)-[(5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methanone (PubChem CID 6567138) has the molecular formula C27H29ClN2O and a molecular weight of 433.00 g/mol. Its IUPAC name is (2-chlorophenyl)-[(5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methanone.
| Compound Name | (2-chlorophenyl)-[(5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methanone |
|---|---|
| PubChem CID | 6567138 |
| Molecular Formula | C27H29ClN2O |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (2-chlorophenyl)-[(5S)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCC[C@@H]31 |
| InChI | InChI=1S/C27H29ClN2O/c28-23-11-5-4-9-21(23)27(31)30-16-15-29-24-14-13-19(18-7-2-1-3-8-18)17-22(24)20-10-6-12-25(30)26(20)29/h4-5,9,11,13-14,17-18,25H,1-3,6-8,10,12,15-16H2/t25-/m0/s1 |
| InChIKey | AWZNDLPVDDDQJZ-VWLOTQADSA-N |
| XLogP | 6.88 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|