C22H20Cl2N2O — CID 1008234
(2,4-dichlorophenyl)-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methanone (PubChem CID 1008234) has the molecular formula C22H20Cl2N2O and a molecular weight of 399.32 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methanone.
| Compound Name | (2,4-dichlorophenyl)-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methanone |
|---|---|
| PubChem CID | 1008234 |
| Molecular Formula | C22H20Cl2N2O |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (2,4-dichlorophenyl)-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methanone |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(C(=O)c2ccc(Cl)cc2Cl)[C@@H]3CCC1 |
| InChI | InChI=1S/C22H20Cl2N2O/c1-13-5-8-19-17(11-13)15-3-2-4-20-21(15)25(19)9-10-26(20)22(27)16-7-6-14(23)12-18(16)24/h5-8,11-12,20H,2-4,9-10H2,1H3/t20-/m1/s1 |
| InChIKey | BJOIHXZXSCBHCL-HXUWFJFHSA-N |
| XLogP | 5.79 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|