C26H37N3O — CID 1008313
1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-(diethylamino)ethanone (PubChem CID 1008313) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-(diethylamino)ethanone.
| Compound Name | 1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-(diethylamino)ethanone |
|---|---|
| PubChem CID | 1008313 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-(diethylamino)ethanone |
| SMILES | CCN(CC)CC(=O)N1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCC[C@H]31 |
| InChI | InChI=1S/C26H37N3O/c1-3-27(4-2)18-25(30)28-15-16-29-23-14-13-20(19-9-6-5-7-10-19)17-22(23)21-11-8-12-24(28)26(21)29/h13-14,17,19,24H,3-12,15-16,18H2,1-2H3/t24-/m1/s1 |
| InChIKey | SQQAVQYUIVWHNL-XMMPIXPASA-N |
| XLogP | 5.25 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|