C28H36N2O4 — CID 31113864
diethyl 2-[[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methylidene]propanedioate (PubChem CID 31113864) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is diethyl 2-[[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 31113864 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | diethyl 2-[[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCC[C@H]31)C(=O)OCC |
| InChI | InChI=1S/C28H36N2O4/c1-3-33-27(31)23(28(32)34-4-2)18-29-15-16-30-24-14-13-20(19-9-6-5-7-10-19)17-22(24)21-11-8-12-25(29)26(21)30/h13-14,17-19,25H,3-12,15-16H2,1-2H3/t25-/m1/s1 |
| InChIKey | PJDOQBKYZIJBSA-RUZDIDTESA-N |
| XLogP | 5.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|