C30H35FN4O — CID 4636903
2-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-N-[1-(4-fluorophenyl)ethylideneamino]acetamide (PubChem CID 4636903) has the molecular formula C30H35FN4O and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-N-[1-(4-fluorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-N-[1-(4-fluorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 4636903 |
| Molecular Formula | C30H35FN4O |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 2-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-N-[1-(4-fluorophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CN1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCCC31)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H35FN4O/c1-20(21-10-13-24(31)14-11-21)32-33-29(36)19-34-16-17-35-27-15-12-23(22-6-3-2-4-7-22)18-26(27)25-8-5-9-28(34)30(25)35/h10-15,18,22,28H,2-9,16-17,19H2,1H3,(H,33,36) |
| InChIKey | JJRLVVICGUGEEQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|