C24H26N4O2 — CID 135708350
N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide (PubChem CID 135708350) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide |
|---|---|
| PubChem CID | 135708350 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(CC(=O)N/N=C/c2ccc(O)cc2)[C@@H]3CCC1 |
| InChI | InChI=1S/C24H26N4O2/c1-16-5-10-21-20(13-16)19-3-2-4-22-24(19)28(21)12-11-27(22)15-23(30)26-25-14-17-6-8-18(29)9-7-17/h5-10,13-14,22,29H,2-4,11-12,15H2,1H3,(H,26,30)/b25-14+/t22-/m1/s1 |
| InChIKey | SHQCJTGCYLLFFF-FDCKDHBTSA-N |
| XLogP | 3.50 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|