C25H29N4O2+ — CID 7376250
N-[(Z)-(4-methoxyphenyl)methylideneamino]-2-[(5S)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide (PubChem CID 7376250) has the molecular formula C25H29N4O2+ and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[(Z)-(4-methoxyphenyl)methylideneamino]-2-[(5S)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide.
| Compound Name | N-[(Z)-(4-methoxyphenyl)methylideneamino]-2-[(5S)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide |
|---|---|
| PubChem CID | 7376250 |
| Molecular Formula | C25H29N4O2+ |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-[(Z)-(4-methoxyphenyl)methylideneamino]-2-[(5S)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)C[NH+]2CCn3c4c(c5cc(C)ccc53)CCC[C@@H]42)cc1 |
| InChI | InChI=1S/C25H28N4O2/c1-17-6-11-22-21(14-17)20-4-3-5-23-25(20)29(22)13-12-28(23)16-24(30)27-26-15-18-7-9-19(31-2)10-8-18/h6-11,14-15,23H,3-5,12-13,16H2,1-2H3,(H,27,30)/p+1/b26-15-/t23-/m0/s1 |
| InChIKey | VPTIQEBJXAMJQM-VNAAUWNKSA-O |
| XLogP | 2.38 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|