C18H25N2O+ — CID 7069242
(2R)-1-[(5R)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol (PubChem CID 7069242) has the molecular formula C18H25N2O+ and a molecular weight of 285.41 g/mol. Its IUPAC name is (2R)-1-[(5R)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol.
| Compound Name | (2R)-1-[(5R)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 7069242 |
| Molecular Formula | C18H25N2O+ |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | (2R)-1-[(5R)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol |
| SMILES | Cc1ccc2c(c1)c1c3n2CC[NH+](C[C@@H](C)O)[C@@H]3CCC1 |
| InChI | InChI=1S/C18H24N2O/c1-12-6-7-16-15(10-12)14-4-3-5-17-18(14)20(16)9-8-19(17)11-13(2)21/h6-7,10,13,17,21H,3-5,8-9,11H2,1-2H3/p+1/t13-,17-/m1/s1 |
| InChIKey | DEOZQAROUMJIFA-CXAGYDPISA-O |
| XLogP | 1.61 |
| TPSA | 29.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|