C27H43N3O+2 — CID 6569311
[(2S)-3-[(5S)-12-cyclohexyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-hydroxypropyl]-diethylazanium (PubChem CID 6569311) has the molecular formula C27H43N3O+2 and a molecular weight of 425.66 g/mol. Its IUPAC name is [(2S)-3-[(5S)-12-cyclohexyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-hydroxypropyl]-diethylazanium.
| Compound Name | [(2S)-3-[(5S)-12-cyclohexyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-hydroxypropyl]-diethylazanium |
|---|---|
| PubChem CID | 6569311 |
| Molecular Formula | C27H43N3O+2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.34 |
| IUPAC Name | [(2S)-3-[(5S)-12-cyclohexyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-hydroxypropyl]-diethylazanium |
| SMILES | CC[NH+](CC)C[C@H](O)C[NH+]1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCC[C@@H]31 |
| InChI | InChI=1S/C27H41N3O/c1-3-28(4-2)18-22(31)19-29-15-16-30-25-14-13-21(20-9-6-5-7-10-20)17-24(25)23-11-8-12-26(29)27(23)30/h13-14,17,20,22,26,31H,3-12,15-16,18-19H2,1-2H3/p+2/t22-,26-/m0/s1 |
| InChIKey | SZZYEQZKCICRNH-NVQXNPDNSA-P |
| XLogP | 2.25 |
| TPSA | 34.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|