C21H29N2+ — CID 6984827
(5S)-13-cyclohexyl-1-aza-4-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11(16),12,14-tetraene (PubChem CID 6984827) has the molecular formula C21H29N2+ and a molecular weight of 309.48 g/mol. Its IUPAC name is (5S)-13-cyclohexyl-1-aza-4-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11(16),12,14-tetraene.
| Compound Name | (5S)-13-cyclohexyl-1-aza-4-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 6984827 |
| Molecular Formula | C21H29N2+ |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (5S)-13-cyclohexyl-1-aza-4-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11(16),12,14-tetraene |
| SMILES | c1cc2c(cc1C1CCCCC1)c1c3n2CC[NH2+][C@H]3CCCC1 |
| InChI | InChI=1S/C21H28N2/c1-2-6-15(7-3-1)16-10-11-20-18(14-16)17-8-4-5-9-19-21(17)23(20)13-12-22-19/h10-11,14-15,19,22H,1-9,12-13H2/p+1/t19-/m0/s1 |
| InChIKey | YWYLDQOXACQSKT-IBGZPJMESA-O |
| XLogP | 4.03 |
| TPSA | 21.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|