C27H29N2+ — CID 7464007
(5S)-14-methyl-6-(naphthalen-2-ylmethyl)-10-aza-6-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene (PubChem CID 7464007) has the molecular formula C27H29N2+ and a molecular weight of 381.54 g/mol. Its IUPAC name is (5S)-14-methyl-6-(naphthalen-2-ylmethyl)-10-aza-6-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene.
| Compound Name | (5S)-14-methyl-6-(naphthalen-2-ylmethyl)-10-aza-6-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 7464007 |
| Molecular Formula | C27H29N2+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (5S)-14-methyl-6-(naphthalen-2-ylmethyl)-10-aza-6-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene |
| SMILES | Cc1ccc2c(c1)c1c3n2CCC[NH+](Cc2ccc4ccccc4c2)[C@H]3CCC1 |
| InChI | InChI=1S/C27H28N2/c1-19-10-13-25-24(16-19)23-8-4-9-26-27(23)29(25)15-5-14-28(26)18-20-11-12-21-6-2-3-7-22(21)17-20/h2-3,6-7,10-13,16-17,26H,4-5,8-9,14-15,18H2,1H3/p+1/t26-/m0/s1 |
| InChIKey | SBUWIXOOCSFQCW-SANMLTNESA-O |
| XLogP | 4.97 |
| TPSA | 9.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|