C23H26N3O2+ — CID 7463969
(5R)-14-methyl-6-[(2-nitrophenyl)methyl]-10-aza-6-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene (PubChem CID 7463969) has the molecular formula C23H26N3O2+ and a molecular weight of 376.48 g/mol. Its IUPAC name is (5R)-14-methyl-6-[(2-nitrophenyl)methyl]-10-aza-6-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene.
| Compound Name | (5R)-14-methyl-6-[(2-nitrophenyl)methyl]-10-aza-6-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene |
|---|---|
| PubChem CID | 7463969 |
| Molecular Formula | C23H26N3O2+ |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (5R)-14-methyl-6-[(2-nitrophenyl)methyl]-10-aza-6-azoniatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11(16),12,14-tetraene |
| SMILES | Cc1ccc2c(c1)c1c3n2CCC[NH+](Cc2ccccc2[N+](=O)[O-])[C@@H]3CCC1 |
| InChI | InChI=1S/C23H25N3O2/c1-16-10-11-21-19(14-16)18-7-4-9-22-23(18)25(21)13-5-12-24(22)15-17-6-2-3-8-20(17)26(27)28/h2-3,6,8,10-11,14,22H,4-5,7,9,12-13,15H2,1H3/p+1/t22-/m1/s1 |
| InChIKey | LKFIBCLULSLIKJ-JOCHJYFZSA-O |
| XLogP | 3.72 |
| TPSA | 52.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|