C22H23N5O4 — CID 6556960
2-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide (PubChem CID 6556960) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6556960 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(CC(=O)N/N=C\c2ccc([N+](=O)[O-])o2)[C@H]3CCC1 |
| InChI | InChI=1S/C22H23N5O4/c1-14-5-7-18-17(11-14)16-3-2-4-19-22(16)26(18)10-9-25(19)13-20(28)24-23-12-15-6-8-21(31-15)27(29)30/h5-8,11-12,19H,2-4,9-10,13H2,1H3,(H,24,28)/b23-12-/t19-/m0/s1 |
| InChIKey | KEEPGHZIENGBLU-OLRBPVQESA-N |
| XLogP | 3.29 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|