C31H36N4O4 — CID 2044850
ethyl 5-methoxy-1,2-dimethyl-4-[[2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetyl]amino]indole-3-carboxylate (PubChem CID 2044850) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is ethyl 5-methoxy-1,2-dimethyl-4-[[2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetyl]amino]indole-3-carboxylate.
| Compound Name | ethyl 5-methoxy-1,2-dimethyl-4-[[2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetyl]amino]indole-3-carboxylate |
|---|---|
| PubChem CID | 2044850 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | ethyl 5-methoxy-1,2-dimethyl-4-[[2-[(5R)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]acetyl]amino]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)c2ccc(OC)c(NC(=O)CN3CCn4c5c(c6cc(C)ccc64)CCC[C@H]53)c12 |
| InChI | InChI=1S/C31H36N4O4/c1-6-39-31(37)27-19(3)33(4)23-12-13-25(38-5)29(28(23)27)32-26(36)17-34-14-15-35-22-11-10-18(2)16-21(22)20-8-7-9-24(34)30(20)35/h10-13,16,24H,6-9,14-15,17H2,1-5H3,(H,32,36)/t24-/m1/s1 |
| InChIKey | GNWYAYMHOMYHHK-XMMPIXPASA-N |
| XLogP | 5.27 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|