C31H34N4OS — CID 1008302
1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]ethanone (PubChem CID 1008302) has the molecular formula C31H34N4OS and a molecular weight of 510.71 g/mol. Its IUPAC name is 1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 1008302 |
| Molecular Formula | C31H34N4OS |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 1-[(5R)-12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-2-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]ethanone |
| SMILES | O=C(CSc1ncc(-c2ccccc2)[nH]1)N1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCC[C@H]31 |
| InChI | InChI=1S/C31H34N4OS/c36-29(20-37-31-32-19-26(33-31)22-10-5-2-6-11-22)34-16-17-35-27-15-14-23(21-8-3-1-4-9-21)18-25(27)24-12-7-13-28(34)30(24)35/h2,5-6,10-11,14-15,18-19,21,28H,1,3-4,7-9,12-13,16-17,20H2,(H,32,33)/t28-/m1/s1 |
| InChIKey | HIIOEMAQUVMUJR-MUUNZHRXSA-N |
| XLogP | 7.09 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|