C16H16N2O7 — CID 5037457
5-[[3-carboxy-2-(furan-2-ylmethylamino)propanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 5037457) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is 5-[[3-carboxy-2-(furan-2-ylmethylamino)propanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[3-carboxy-2-(furan-2-ylmethylamino)propanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 5037457 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5-[[3-carboxy-2-(furan-2-ylmethylamino)propanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)CC(NCc1ccco1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H16N2O7/c19-13-4-3-9(6-11(13)16(23)24)18-15(22)12(7-14(20)21)17-8-10-2-1-5-25-10/h1-6,12,17,19H,7-8H2,(H,18,22)(H,20,21)(H,23,24) |
| InChIKey | VIYFPBXLEAMKTA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|