C19H22N4O3 — CID 504024
7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hept-6-ynoic acid (PubChem CID 504024) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hept-6-ynoic acid.
| Compound Name | 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hept-6-ynoic acid |
|---|---|
| PubChem CID | 504024 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 7-[3-[(2,4-diaminopyrimidin-5-yl)methyl]-4-methoxyphenyl]hept-6-ynoic acid |
| SMILES | COc1ccc(C#CCCCCC(=O)O)cc1Cc1cnc(N)nc1N |
| InChI | InChI=1S/C19H22N4O3/c1-26-16-9-8-13(6-4-2-3-5-7-17(24)25)10-14(16)11-15-12-22-19(21)23-18(15)20/h8-10,12H,2-3,5,7,11H2,1H3,(H,24,25)(H4,20,21,22,23) |
| InChIKey | CIUYZEMTWPMSNU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|